C28H42O4P+ — CID 21130801
[2,4-ditert-butyl-6-(3,5-ditert-butyl-2-hydroxyphenyl)phenoxy]-hydroxy-oxophosphanium (PubChem CID 21130801) has the molecular formula C28H42O4P+ and a molecular weight of 473.61 g/mol. Its IUPAC name is [2,4-ditert-butyl-6-(3,5-ditert-butyl-2-hydroxyphenyl)phenoxy]-hydroxy-oxophosphanium.
| Compound Name | [2,4-ditert-butyl-6-(3,5-ditert-butyl-2-hydroxyphenyl)phenoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 21130801 |
| Molecular Formula | C28H42O4P+ |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | [2,4-ditert-butyl-6-(3,5-ditert-butyl-2-hydroxyphenyl)phenoxy]-hydroxy-oxophosphanium |
| SMILES | CC(C)(C)c1cc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2O[P+](=O)O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H41O4P/c1-25(2,3)17-13-19(23(29)21(15-17)27(7,8)9)20-14-18(26(4,5)6)16-22(28(10,11)12)24(20)32-33(30)31/h13-16H,1-12H3,(H-,29,30,31)/p+1 |
| InChIKey | PLQCURZISSCTLF-UHFFFAOYSA-O |
| XLogP | 8.28 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|