C18H32O4Si — CID 162081075
dihydroxy-(2,4,6-tritert-butylphenyl)peroxysilane (PubChem CID 162081075) has the molecular formula C18H32O4Si and a molecular weight of 340.54 g/mol. Its IUPAC name is dihydroxy-(2,4,6-tritert-butylphenyl)peroxysilane.
| Compound Name | dihydroxy-(2,4,6-tritert-butylphenyl)peroxysilane |
|---|---|
| PubChem CID | 162081075 |
| Molecular Formula | C18H32O4Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | dihydroxy-(2,4,6-tritert-butylphenyl)peroxysilane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(OO[SiH](O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H32O4Si/c1-16(2,3)12-10-13(17(4,5)6)15(21-22-23(19)20)14(11-12)18(7,8)9/h10-11,19-20,23H,1-9H3 |
| InChIKey | NQOFVQOPPWSNEO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|