C19H32O3S — CID 87391477
(2,4,6-tritert-butylphenyl) methanesulfonate (PubChem CID 87391477) has the molecular formula C19H32O3S and a molecular weight of 340.53 g/mol. Its IUPAC name is (2,4,6-tritert-butylphenyl) methanesulfonate.
| Compound Name | (2,4,6-tritert-butylphenyl) methanesulfonate |
|---|---|
| PubChem CID | 87391477 |
| Molecular Formula | C19H32O3S |
| Molecular Weight | 340.53 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | (2,4,6-tritert-butylphenyl) methanesulfonate |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(OS(C)(=O)=O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H32O3S/c1-17(2,3)13-11-14(18(4,5)6)16(22-23(10,20)21)15(12-13)19(7,8)9/h11-12H,1-10H3 |
| InChIKey | YDTZURKVRIOEJT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|