C11H15O6S2- — CID 176845919
2-tert-butyl-4-methylsulfonyloxybenzenesulfonate (PubChem CID 176845919) has the molecular formula C11H15O6S2- and a molecular weight of 307.37 g/mol. Its IUPAC name is 2-tert-butyl-4-methylsulfonyloxybenzenesulfonate.
| Compound Name | 2-tert-butyl-4-methylsulfonyloxybenzenesulfonate |
|---|---|
| PubChem CID | 176845919 |
| Molecular Formula | C11H15O6S2- |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 2-tert-butyl-4-methylsulfonyloxybenzenesulfonate |
| SMILES | CC(C)(C)c1cc(OS(C)(=O)=O)ccc1S(=O)(=O)[O-] |
| InChI | InChI=1S/C11H16O6S2/c1-11(2,3)9-7-8(17-18(4,12)13)5-6-10(9)19(14,15)16/h5-7H,1-4H3,(H,14,15,16)/p-1 |
| InChIKey | DXYRSDPLHQDZFP-UHFFFAOYSA-M |
| XLogP | 1.23 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|