C16H23O5S- — CID 177105500
4-acetyloxy-2,6-ditert-butylbenzenesulfonate (PubChem CID 177105500) has the molecular formula C16H23O5S- and a molecular weight of 327.42 g/mol. Its IUPAC name is 4-acetyloxy-2,6-ditert-butylbenzenesulfonate.
| Compound Name | 4-acetyloxy-2,6-ditert-butylbenzenesulfonate |
|---|---|
| PubChem CID | 177105500 |
| Molecular Formula | C16H23O5S- |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 4-acetyloxy-2,6-ditert-butylbenzenesulfonate |
| SMILES | CC(=O)Oc1cc(C(C)(C)C)c(S(=O)(=O)[O-])c(C(C)(C)C)c1 |
| InChI | InChI=1S/C16H24O5S/c1-10(17)21-11-8-12(15(2,3)4)14(22(18,19)20)13(9-11)16(5,6)7/h8-9H,1-7H3,(H,18,19,20)/p-1 |
| InChIKey | IDGRXWVZHMXSIL-UHFFFAOYSA-M |
| XLogP | 3.11 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|