C12H16FO3S- — CID 58734562
4-tert-butyl-3-fluoro-2,6-dimethylbenzenesulfonate (PubChem CID 58734562) has the molecular formula C12H16FO3S- and a molecular weight of 259.32 g/mol. Its IUPAC name is 4-tert-butyl-3-fluoro-2,6-dimethylbenzenesulfonate.
| Compound Name | 4-tert-butyl-3-fluoro-2,6-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 58734562 |
| Molecular Formula | C12H16FO3S- |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 4-tert-butyl-3-fluoro-2,6-dimethylbenzenesulfonate |
| SMILES | Cc1cc(C(C)(C)C)c(F)c(C)c1S(=O)(=O)[O-] |
| InChI | InChI=1S/C12H17FO3S/c1-7-6-9(12(3,4)5)10(13)8(2)11(7)17(14,15)16/h6H,1-5H3,(H,14,15,16)/p-1 |
| InChIKey | NUDCTYQPMQCAKC-UHFFFAOYSA-M |
| XLogP | 2.64 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|