C12H17KO3S — CID 20826281
potassium 2,4-diethyl-3,6-dimethylbenzenesulfonate (PubChem CID 20826281) has the molecular formula C12H17KO3S and a molecular weight of 280.43 g/mol. Its IUPAC name is potassium 2,4-diethyl-3,6-dimethylbenzenesulfonate.
| Compound Name | potassium 2,4-diethyl-3,6-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 20826281 |
| Molecular Formula | C12H17KO3S |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | potassium 2,4-diethyl-3,6-dimethylbenzenesulfonate |
| SMILES | CCc1cc(C)c(S(=O)(=O)[O-])c(CC)c1C.[K+] |
| InChI | InChI=1S/C12H18O3S.K/c1-5-10-7-8(3)12(16(13,14)15)11(6-2)9(10)4;/h7H,5-6H2,1-4H3,(H,13,14,15);/q;+1/p-1 |
| InChIKey | NCEPXMAJGXFLIC-UHFFFAOYSA-M |
| XLogP | -0.66 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|