C8H7Cl2LiO3S — CID 162685742
lithium 2,5-dichloro-3,6-dimethylbenzenesulfonate (PubChem CID 162685742) has the molecular formula C8H7Cl2LiO3S and a molecular weight of 261.05 g/mol. Its IUPAC name is lithium 2,5-dichloro-3,6-dimethylbenzenesulfonate.
| Compound Name | lithium 2,5-dichloro-3,6-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 162685742 |
| Molecular Formula | C8H7Cl2LiO3S |
| Molecular Weight | 261.05 g/mol |
| Exact Mass | 259.97 |
| IUPAC Name | lithium 2,5-dichloro-3,6-dimethylbenzenesulfonate |
| SMILES | Cc1cc(Cl)c(C)c(S(=O)(=O)[O-])c1Cl.[Li+] |
| InChI | InChI=1S/C8H8Cl2O3S.Li/c1-4-3-6(9)5(2)8(7(4)10)14(11,12)13;/h3H,1-2H3,(H,11,12,13);/q;+1/p-1 |
| InChIKey | ZJFFZJSLBCNQQS-UHFFFAOYSA-M |
| XLogP | -0.48 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.05 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|