C11H16Cl2N2O2S — CID 43605726
N-(3-aminopropyl)-2,5-dichloro-3,6-dimethylbenzenesulfonamide (PubChem CID 43605726) has the molecular formula C11H16Cl2N2O2S and a molecular weight of 311.23 g/mol. Its IUPAC name is N-(3-aminopropyl)-2,5-dichloro-3,6-dimethylbenzenesulfonamide.
| Compound Name | N-(3-aminopropyl)-2,5-dichloro-3,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 43605726 |
| Molecular Formula | C11H16Cl2N2O2S |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | N-(3-aminopropyl)-2,5-dichloro-3,6-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(Cl)c(C)c(S(=O)(=O)NCCCN)c1Cl |
| InChI | InChI=1S/C11H16Cl2N2O2S/c1-7-6-9(12)8(2)11(10(7)13)18(16,17)15-5-3-4-14/h6,15H,3-5,14H2,1-2H3 |
| InChIKey | AYEXQQODJKJVQZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|