C12H18Cl2N2O2S — CID 65193954
N-(1-aminobutan-2-yl)-2,5-dichloro-3,6-dimethylbenzenesulfonamide (PubChem CID 65193954) has the molecular formula C12H18Cl2N2O2S and a molecular weight of 325.26 g/mol. Its IUPAC name is N-(1-aminobutan-2-yl)-2,5-dichloro-3,6-dimethylbenzenesulfonamide.
| Compound Name | N-(1-aminobutan-2-yl)-2,5-dichloro-3,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 65193954 |
| Molecular Formula | C12H18Cl2N2O2S |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | N-(1-aminobutan-2-yl)-2,5-dichloro-3,6-dimethylbenzenesulfonamide |
| SMILES | CCC(CN)NS(=O)(=O)c1c(C)c(Cl)cc(C)c1Cl |
| InChI | InChI=1S/C12H18Cl2N2O2S/c1-4-9(6-15)16-19(17,18)12-8(3)10(13)5-7(2)11(12)14/h5,9,16H,4,6,15H2,1-3H3 |
| InChIKey | WVEIKYZFYSJHRX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |