C8H9Cl2LiO3S — CID 174049527
lithium;2,5-dichloro-3,6-dimethylbenzenesulfonic acid;hydride (PubChem CID 174049527) has the molecular formula C8H9Cl2LiO3S and a molecular weight of 263.07 g/mol. Its IUPAC name is lithium;2,5-dichloro-3,6-dimethylbenzenesulfonic acid;hydride.
| Compound Name | lithium;2,5-dichloro-3,6-dimethylbenzenesulfonic acid;hydride |
|---|---|
| PubChem CID | 174049527 |
| Molecular Formula | C8H9Cl2LiO3S |
| Molecular Weight | 263.07 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | lithium;2,5-dichloro-3,6-dimethylbenzenesulfonic acid;hydride |
| SMILES | Cc1cc(Cl)c(C)c(S(=O)(=O)O)c1Cl.[H-].[Li+] |
| InChI | InChI=1S/C8H8Cl2O3S.Li.H/c1-4-3-6(9)5(2)8(7(4)10)14(11,12)13;;/h3H,1-2H3,(H,11,12,13);;/q;+1;-1 |
| InChIKey | ZOTGCVATTAKKED-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.07 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|