C8H10Cl2O3S — CID 174264022
2-chloro-3,6-dimethylbenzenesulfonic acid;hydrochloride (PubChem CID 174264022) has the molecular formula C8H10Cl2O3S and a molecular weight of 257.14 g/mol. Its IUPAC name is 2-chloro-3,6-dimethylbenzenesulfonic acid;hydrochloride.
| Compound Name | 2-chloro-3,6-dimethylbenzenesulfonic acid;hydrochloride |
|---|---|
| PubChem CID | 174264022 |
| Molecular Formula | C8H10Cl2O3S |
| Molecular Weight | 257.14 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | 2-chloro-3,6-dimethylbenzenesulfonic acid;hydrochloride |
| SMILES | Cc1ccc(C)c(S(=O)(=O)O)c1Cl.Cl |
| InChI | InChI=1S/C8H9ClO3S.ClH/c1-5-3-4-6(2)8(7(5)9)13(10,11)12;/h3-4H,1-2H3,(H,10,11,12);1H |
| InChIKey | ICAAVDMMVWCSAJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.14 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|