C10H11Cl2NO5S — CID 60661414
2-[(2,5-dichloro-3,6-dimethylphenyl)sulfonylamino]oxyacetic acid (PubChem CID 60661414) has the molecular formula C10H11Cl2NO5S and a molecular weight of 328.17 g/mol. Its IUPAC name is 2-[(2,5-dichloro-3,6-dimethylphenyl)sulfonylamino]oxyacetic acid.
| Compound Name | 2-[(2,5-dichloro-3,6-dimethylphenyl)sulfonylamino]oxyacetic acid |
|---|---|
| PubChem CID | 60661414 |
| Molecular Formula | C10H11Cl2NO5S |
| Molecular Weight | 328.17 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | 2-[(2,5-dichloro-3,6-dimethylphenyl)sulfonylamino]oxyacetic acid |
| SMILES | Cc1cc(Cl)c(C)c(S(=O)(=O)NOCC(=O)O)c1Cl |
| InChI | InChI=1S/C10H11Cl2NO5S/c1-5-3-7(11)6(2)10(9(5)12)19(16,17)13-18-4-8(14)15/h3,13H,4H2,1-2H3,(H,14,15) |
| InChIKey | VACFRYKJLAIEHK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.17 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|