C10H14BrClN2O2S — CID 65193946
N-(1-aminobutan-2-yl)-4-bromo-2-chlorobenzenesulfonamide (PubChem CID 65193946) has the molecular formula C10H14BrClN2O2S and a molecular weight of 341.66 g/mol. Its IUPAC name is N-(1-aminobutan-2-yl)-4-bromo-2-chlorobenzenesulfonamide.
| Compound Name | N-(1-aminobutan-2-yl)-4-bromo-2-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 65193946 |
| Molecular Formula | C10H14BrClN2O2S |
| Molecular Weight | 341.66 g/mol |
| Exact Mass | 339.96 |
| IUPAC Name | N-(1-aminobutan-2-yl)-4-bromo-2-chlorobenzenesulfonamide |
| SMILES | CCC(CN)NS(=O)(=O)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C10H14BrClN2O2S/c1-2-8(6-13)14-17(15,16)10-4-3-7(11)5-9(10)12/h3-5,8,14H,2,6,13H2,1H3 |
| InChIKey | ILJVACMOFCGBSE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.66 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |