C16H29ClN2O2S — CID 120583236
N-(4-aminobutyl)-4-tert-butyl-2,6-dimethylbenzenesulfonamide;hydrochloride (PubChem CID 120583236) has the molecular formula C16H29ClN2O2S and a molecular weight of 348.94 g/mol. Its IUPAC name is N-(4-aminobutyl)-4-tert-butyl-2,6-dimethylbenzenesulfonamide;hydrochloride.
| Compound Name | N-(4-aminobutyl)-4-tert-butyl-2,6-dimethylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120583236 |
| Molecular Formula | C16H29ClN2O2S |
| Molecular Weight | 348.94 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-(4-aminobutyl)-4-tert-butyl-2,6-dimethylbenzenesulfonamide;hydrochloride |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1S(=O)(=O)NCCCCN.Cl |
| InChI | InChI=1S/C16H28N2O2S.ClH/c1-12-10-14(16(3,4)5)11-13(2)15(12)21(19,20)18-9-7-6-8-17;/h10-11,18H,6-9,17H2,1-5H3;1H |
| InChIKey | IGVILZYRKPZVNS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.94 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|