C15H26N2O2S — CID 119973128
4-tert-butyl-2,6-dimethyl-N-[2-(methylamino)ethyl]benzenesulfonamide (PubChem CID 119973128) has the molecular formula C15H26N2O2S and a molecular weight of 298.45 g/mol. Its IUPAC name is 4-tert-butyl-2,6-dimethyl-N-[2-(methylamino)ethyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-2,6-dimethyl-N-[2-(methylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 119973128 |
| Molecular Formula | C15H26N2O2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 4-tert-butyl-2,6-dimethyl-N-[2-(methylamino)ethyl]benzenesulfonamide |
| SMILES | CNCCNS(=O)(=O)c1c(C)cc(C(C)(C)C)cc1C |
| InChI | InChI=1S/C15H26N2O2S/c1-11-9-13(15(3,4)5)10-12(2)14(11)20(18,19)17-8-7-16-6/h9-10,16-17H,7-8H2,1-6H3 |
| InChIKey | IQDPQNNHIZFSDY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|