C13H22N2O2S — CID 62659681
2,3,5,6-tetramethyl-N-[2-(methylamino)ethyl]benzenesulfonamide (PubChem CID 62659681) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is 2,3,5,6-tetramethyl-N-[2-(methylamino)ethyl]benzenesulfonamide.
| Compound Name | 2,3,5,6-tetramethyl-N-[2-(methylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 62659681 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2,3,5,6-tetramethyl-N-[2-(methylamino)ethyl]benzenesulfonamide |
| SMILES | CNCCNS(=O)(=O)c1c(C)c(C)cc(C)c1C |
| InChI | InChI=1S/C13H22N2O2S/c1-9-8-10(2)12(4)13(11(9)3)18(16,17)15-7-6-14-5/h8,14-15H,6-7H2,1-5H3 |
| InChIKey | SVPYCQMOVVGGDG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|