C14H21NO4S — CID 2437240
4-[(2,3,5,6-tetramethylphenyl)sulfonylamino]butanoic acid (PubChem CID 2437240) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is 4-[(2,3,5,6-tetramethylphenyl)sulfonylamino]butanoic acid.
| Compound Name | 4-[(2,3,5,6-tetramethylphenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 2437240 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 4-[(2,3,5,6-tetramethylphenyl)sulfonylamino]butanoic acid |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)NCCCC(=O)O)c1C |
| InChI | InChI=1S/C14H21NO4S/c1-9-8-10(2)12(4)14(11(9)3)20(18,19)15-7-5-6-13(16)17/h8,15H,5-7H2,1-4H3,(H,16,17) |
| InChIKey | VUMSWKCPJSILTE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|