C14H22N2O6S2 — CID 18590180
4-[[2,4-dimethyl-5-[methyl(methylsulfonyl)amino]phenyl]sulfonylamino]butanoic acid (PubChem CID 18590180) has the molecular formula C14H22N2O6S2 and a molecular weight of 378.47 g/mol. Its IUPAC name is 4-[[2,4-dimethyl-5-[methyl(methylsulfonyl)amino]phenyl]sulfonylamino]butanoic acid.
| Compound Name | 4-[[2,4-dimethyl-5-[methyl(methylsulfonyl)amino]phenyl]sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 18590180 |
| Molecular Formula | C14H22N2O6S2 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 4-[[2,4-dimethyl-5-[methyl(methylsulfonyl)amino]phenyl]sulfonylamino]butanoic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)NCCCC(=O)O)cc1N(C)S(C)(=O)=O |
| InChI | InChI=1S/C14H22N2O6S2/c1-10-8-11(2)13(9-12(10)16(3)23(4,19)20)24(21,22)15-7-5-6-14(17)18/h8-9,15H,5-7H2,1-4H3,(H,17,18) |
| InChIKey | PAFGMLYBLKEPKB-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|