C14H21N2O6S2- — CID 7730632
4-[[2,4-dimethyl-3-[methyl(methylsulfonyl)amino]phenyl]sulfonylamino]butanoate (PubChem CID 7730632) has the molecular formula C14H21N2O6S2- and a molecular weight of 377.46 g/mol. Its IUPAC name is 4-[[2,4-dimethyl-3-[methyl(methylsulfonyl)amino]phenyl]sulfonylamino]butanoate.
| Compound Name | 4-[[2,4-dimethyl-3-[methyl(methylsulfonyl)amino]phenyl]sulfonylamino]butanoate |
|---|---|
| PubChem CID | 7730632 |
| Molecular Formula | C14H21N2O6S2- |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 4-[[2,4-dimethyl-3-[methyl(methylsulfonyl)amino]phenyl]sulfonylamino]butanoate |
| SMILES | Cc1ccc(S(=O)(=O)NCCCC(=O)[O-])c(C)c1N(C)S(C)(=O)=O |
| InChI | InChI=1S/C14H22N2O6S2/c1-10-7-8-12(11(2)14(10)16(3)23(4,19)20)24(21,22)15-9-5-6-13(17)18/h7-8,15H,5-6,9H2,1-4H3,(H,17,18)/p-1 |
| InChIKey | GISQLCRXXLFPIA-UHFFFAOYSA-M |
| XLogP | -0.49 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|