C10H10N3O5S- — CID 4105183
4-(2,1,3-benzoxadiazol-4-ylsulfonylamino)butanoate (PubChem CID 4105183) has the molecular formula C10H10N3O5S- and a molecular weight of 284.27 g/mol. Its IUPAC name is 4-(2,1,3-benzoxadiazol-4-ylsulfonylamino)butanoate.
| Compound Name | 4-(2,1,3-benzoxadiazol-4-ylsulfonylamino)butanoate |
|---|---|
| PubChem CID | 4105183 |
| Molecular Formula | C10H10N3O5S- |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 4-(2,1,3-benzoxadiazol-4-ylsulfonylamino)butanoate |
| SMILES | O=C([O-])CCCNS(=O)(=O)c1cccc2nonc12 |
| InChI | InChI=1S/C10H11N3O5S/c14-9(15)5-2-6-11-19(16,17)8-4-1-3-7-10(8)13-18-12-7/h1,3-4,11H,2,5-6H2,(H,14,15)/p-1 |
| InChIKey | FNWGIPIXMZJVCQ-UHFFFAOYSA-M |
| XLogP | -0.97 |
| TPSA | 125.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|