C19H22N4O3S — CID 58859292
N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2,1,3-benzoxadiazole-4-sulfonamide (PubChem CID 58859292) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2,1,3-benzoxadiazole-4-sulfonamide.
| Compound Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2,1,3-benzoxadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 58859292 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2,1,3-benzoxadiazole-4-sulfonamide |
| SMILES | O=S(=O)(NCCCCN1CCc2ccccc2C1)c1cccc2nonc12 |
| InChI | InChI=1S/C19H22N4O3S/c24-27(25,18-9-5-8-17-19(18)22-26-21-17)20-11-3-4-12-23-13-10-15-6-1-2-7-16(15)14-23/h1-2,5-9,20H,3-4,10-14H2 |
| InChIKey | STWDDKADFRJIEQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|