C19H23FN2O6S2 — CID 71945610
4-[[3-[(4-fluorophenyl)sulfonyl-methylamino]-2,4-dimethylphenyl]sulfonylamino]butanoic acid (PubChem CID 71945610) has the molecular formula C19H23FN2O6S2 and a molecular weight of 458.53 g/mol. Its IUPAC name is 4-[[3-[(4-fluorophenyl)sulfonyl-methylamino]-2,4-dimethylphenyl]sulfonylamino]butanoic acid.
| Compound Name | 4-[[3-[(4-fluorophenyl)sulfonyl-methylamino]-2,4-dimethylphenyl]sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 71945610 |
| Molecular Formula | C19H23FN2O6S2 |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 4-[[3-[(4-fluorophenyl)sulfonyl-methylamino]-2,4-dimethylphenyl]sulfonylamino]butanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)NCCCC(=O)O)c(C)c1N(C)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H23FN2O6S2/c1-13-6-11-17(29(25,26)21-12-4-5-18(23)24)14(2)19(13)22(3)30(27,28)16-9-7-15(20)8-10-16/h6-11,21H,4-5,12H2,1-3H3,(H,23,24) |
| InChIKey | ZNOHDFACKBVSES-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|