C12H17FN2O6S2 — CID 120613630
3-[2-[(4-fluorophenyl)sulfonyl-methylamino]ethylsulfonylamino]propanoic acid (PubChem CID 120613630) has the molecular formula C12H17FN2O6S2 and a molecular weight of 368.41 g/mol. Its IUPAC name is 3-[2-[(4-fluorophenyl)sulfonyl-methylamino]ethylsulfonylamino]propanoic acid.
| Compound Name | 3-[2-[(4-fluorophenyl)sulfonyl-methylamino]ethylsulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 120613630 |
| Molecular Formula | C12H17FN2O6S2 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 3-[2-[(4-fluorophenyl)sulfonyl-methylamino]ethylsulfonylamino]propanoic acid |
| SMILES | CN(CCS(=O)(=O)NCCC(=O)O)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H17FN2O6S2/c1-15(8-9-22(18,19)14-7-6-12(16)17)23(20,21)11-4-2-10(13)3-5-11/h2-5,14H,6-9H2,1H3,(H,16,17) |
| InChIKey | OJFHUWQFHMYARQ-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |