C14H21FN2O6S2 — CID 122070155
2-[2-[(4-fluorophenyl)sulfonyl-methylamino]ethylsulfonylamino]pentanoic acid (PubChem CID 122070155) has the molecular formula C14H21FN2O6S2 and a molecular weight of 396.46 g/mol. Its IUPAC name is 2-[2-[(4-fluorophenyl)sulfonyl-methylamino]ethylsulfonylamino]pentanoic acid.
| Compound Name | 2-[2-[(4-fluorophenyl)sulfonyl-methylamino]ethylsulfonylamino]pentanoic acid |
|---|---|
| PubChem CID | 122070155 |
| Molecular Formula | C14H21FN2O6S2 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 2-[2-[(4-fluorophenyl)sulfonyl-methylamino]ethylsulfonylamino]pentanoic acid |
| SMILES | CCCC(NS(=O)(=O)CCN(C)S(=O)(=O)c1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C14H21FN2O6S2/c1-3-4-13(14(18)19)16-24(20,21)10-9-17(2)25(22,23)12-7-5-11(15)6-8-12/h5-8,13,16H,3-4,9-10H2,1-2H3,(H,18,19) |
| InChIKey | NEJBMRTZBQPDLF-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |