C17H23FN2O5S — CID 120692865
(E)-2-[4-[(4-fluorophenyl)sulfonyl-methylamino]butanoylamino]hex-4-enoic acid (PubChem CID 120692865) has the molecular formula C17H23FN2O5S and a molecular weight of 386.45 g/mol. Its IUPAC name is (E)-2-[4-[(4-fluorophenyl)sulfonyl-methylamino]butanoylamino]hex-4-enoic acid.
| Compound Name | (E)-2-[4-[(4-fluorophenyl)sulfonyl-methylamino]butanoylamino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120692865 |
| Molecular Formula | C17H23FN2O5S |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | (E)-2-[4-[(4-fluorophenyl)sulfonyl-methylamino]butanoylamino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)CCCN(C)S(=O)(=O)c1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C17H23FN2O5S/c1-3-4-6-15(17(22)23)19-16(21)7-5-12-20(2)26(24,25)14-10-8-13(18)9-11-14/h3-4,8-11,15H,5-7,12H2,1-2H3,(H,19,21)(H,22,23)/b4-3+ |
| InChIKey | WBTFPCCUKWPIOS-ONEGZZNKSA-N |
| XLogP | 1.76 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|