C13H14ClNO6S-2 — CID 2133289
3-(5-carboxylatopentylsulfamoyl)-4-chlorobenzoate (PubChem CID 2133289) has the molecular formula C13H14ClNO6S-2 and a molecular weight of 347.78 g/mol. Its IUPAC name is 3-(5-carboxylatopentylsulfamoyl)-4-chlorobenzoate.
| Compound Name | 3-(5-carboxylatopentylsulfamoyl)-4-chlorobenzoate |
|---|---|
| PubChem CID | 2133289 |
| Molecular Formula | C13H14ClNO6S-2 |
| Molecular Weight | 347.78 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 3-(5-carboxylatopentylsulfamoyl)-4-chlorobenzoate |
| SMILES | O=C([O-])CCCCCNS(=O)(=O)c1cc(C(=O)[O-])ccc1Cl |
| InChI | InChI=1S/C13H16ClNO6S/c14-10-6-5-9(13(18)19)8-11(10)22(20,21)15-7-3-1-2-4-12(16)17/h5-6,8,15H,1-4,7H2,(H,16,17)(H,18,19)/p-2 |
| InChIKey | AUXRZMIVAGQQOC-UHFFFAOYSA-L |
| XLogP | -0.71 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.78 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|