C10H10ClNO6S — CID 2100657
3-(2-carboxyethylsulfamoyl)-4-chlorobenzoic acid (PubChem CID 2100657) has the molecular formula C10H10ClNO6S and a molecular weight of 307.71 g/mol. Its IUPAC name is 3-(2-carboxyethylsulfamoyl)-4-chlorobenzoic acid.
| Compound Name | 3-(2-carboxyethylsulfamoyl)-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 2100657 |
| Molecular Formula | C10H10ClNO6S |
| Molecular Weight | 307.71 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 3-(2-carboxyethylsulfamoyl)-4-chlorobenzoic acid |
| SMILES | O=C(O)CCNS(=O)(=O)c1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C10H10ClNO6S/c11-7-2-1-6(10(15)16)5-8(7)19(17,18)12-4-3-9(13)14/h1-2,5,12H,3-4H2,(H,13,14)(H,15,16) |
| InChIKey | MNJAOXYIGRSHPQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.71 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |