C14H14ClN3O4S — CID 45335334
4-chloro-3-[2-(pyridin-2-ylamino)ethylsulfamoyl]benzoic acid (PubChem CID 45335334) has the molecular formula C14H14ClN3O4S and a molecular weight of 355.80 g/mol. Its IUPAC name is 4-chloro-3-[2-(pyridin-2-ylamino)ethylsulfamoyl]benzoic acid.
| Compound Name | 4-chloro-3-[2-(pyridin-2-ylamino)ethylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 45335334 |
| Molecular Formula | C14H14ClN3O4S |
| Molecular Weight | 355.80 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 4-chloro-3-[2-(pyridin-2-ylamino)ethylsulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(S(=O)(=O)NCCNc2ccccn2)c1 |
| InChI | InChI=1S/C14H14ClN3O4S/c15-11-5-4-10(14(19)20)9-12(11)23(21,22)18-8-7-17-13-3-1-2-6-16-13/h1-6,9,18H,7-8H2,(H,16,17)(H,19,20) |
| InChIKey | IRRYGBVQLVYFBY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.80 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|