C14H16N4O4S — CID 138997308
4-methyl-3-[2-(pyrazin-2-ylamino)ethylsulfamoyl]benzoic acid (PubChem CID 138997308) has the molecular formula C14H16N4O4S and a molecular weight of 336.37 g/mol. Its IUPAC name is 4-methyl-3-[2-(pyrazin-2-ylamino)ethylsulfamoyl]benzoic acid.
| Compound Name | 4-methyl-3-[2-(pyrazin-2-ylamino)ethylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 138997308 |
| Molecular Formula | C14H16N4O4S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 4-methyl-3-[2-(pyrazin-2-ylamino)ethylsulfamoyl]benzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1S(=O)(=O)NCCNc1cnccn1 |
| InChI | InChI=1S/C14H16N4O4S/c1-10-2-3-11(14(19)20)8-12(10)23(21,22)18-7-6-17-13-9-15-4-5-16-13/h2-5,8-9,18H,6-7H2,1H3,(H,16,17)(H,19,20) |
| InChIKey | PFMUCDOTOUPZPU-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|