C12H11ClN2O4S2 — CID 110717619
4-chloro-3-[2-(1,3-thiazol-5-yl)ethylsulfamoyl]benzoic acid (PubChem CID 110717619) has the molecular formula C12H11ClN2O4S2 and a molecular weight of 346.82 g/mol. Its IUPAC name is 4-chloro-3-[2-(1,3-thiazol-5-yl)ethylsulfamoyl]benzoic acid.
| Compound Name | 4-chloro-3-[2-(1,3-thiazol-5-yl)ethylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 110717619 |
| Molecular Formula | C12H11ClN2O4S2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | 4-chloro-3-[2-(1,3-thiazol-5-yl)ethylsulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(S(=O)(=O)NCCc2cncs2)c1 |
| InChI | InChI=1S/C12H11ClN2O4S2/c13-10-2-1-8(12(16)17)5-11(10)21(18,19)15-4-3-9-6-14-7-20-9/h1-2,5-7,15H,3-4H2,(H,16,17) |
| InChIKey | OVQVDNKYHGIBIK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |