C11H10Cl2N2O2S2 — CID 110717587
3,4-dichloro-N-[2-(1,3-thiazol-5-yl)ethyl]benzenesulfonamide (PubChem CID 110717587) has the molecular formula C11H10Cl2N2O2S2 and a molecular weight of 337.25 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(1,3-thiazol-5-yl)ethyl]benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-[2-(1,3-thiazol-5-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110717587 |
| Molecular Formula | C11H10Cl2N2O2S2 |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | 3,4-dichloro-N-[2-(1,3-thiazol-5-yl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCc1cncs1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H10Cl2N2O2S2/c12-10-2-1-9(5-11(10)13)19(16,17)15-4-3-8-6-14-7-18-8/h1-2,5-7,15H,3-4H2 |
| InChIKey | NHNGYYFJRFOYMJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |