C11H14BrCl2NO2S — CID 107323042
N-(5-bromopentyl)-3,4-dichlorobenzenesulfonamide (PubChem CID 107323042) has the molecular formula C11H14BrCl2NO2S and a molecular weight of 375.12 g/mol. Its IUPAC name is N-(5-bromopentyl)-3,4-dichlorobenzenesulfonamide.
| Compound Name | N-(5-bromopentyl)-3,4-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 107323042 |
| Molecular Formula | C11H14BrCl2NO2S |
| Molecular Weight | 375.12 g/mol |
| Exact Mass | 372.93 |
| IUPAC Name | N-(5-bromopentyl)-3,4-dichlorobenzenesulfonamide |
| SMILES | O=S(=O)(NCCCCCBr)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H14BrCl2NO2S/c12-6-2-1-3-7-15-18(16,17)9-4-5-10(13)11(14)8-9/h4-5,8,15H,1-3,6-7H2 |
| InChIKey | HECCGCSGZMBMAB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.12 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|