C12H13Cl2N5O3S — CID 167871892
4-[(3,4-dichlorophenyl)sulfonylamino]-N-(2H-triazol-4-yl)butanamide (PubChem CID 167871892) has the molecular formula C12H13Cl2N5O3S and a molecular weight of 378.24 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)sulfonylamino]-N-(2H-triazol-4-yl)butanamide.
| Compound Name | 4-[(3,4-dichlorophenyl)sulfonylamino]-N-(2H-triazol-4-yl)butanamide |
|---|---|
| PubChem CID | 167871892 |
| Molecular Formula | C12H13Cl2N5O3S |
| Molecular Weight | 378.24 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)sulfonylamino]-N-(2H-triazol-4-yl)butanamide |
| SMILES | O=C(CCCNS(=O)(=O)c1ccc(Cl)c(Cl)c1)Nc1cn[nH]n1 |
| InChI | InChI=1S/C12H13Cl2N5O3S/c13-9-4-3-8(6-10(9)14)23(21,22)16-5-1-2-12(20)17-11-7-15-19-18-11/h3-4,6-7,16H,1-2,5H2,(H2,15,17,18,19,20) |
| InChIKey | JLBVYRJHNLSJPV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|