C12H15Cl2NO3S — CID 115698683
3,4-dichloro-N-[2-(2-methylprop-2-enoxy)ethyl]benzenesulfonamide (PubChem CID 115698683) has the molecular formula C12H15Cl2NO3S and a molecular weight of 324.23 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(2-methylprop-2-enoxy)ethyl]benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-[2-(2-methylprop-2-enoxy)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 115698683 |
| Molecular Formula | C12H15Cl2NO3S |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 3,4-dichloro-N-[2-(2-methylprop-2-enoxy)ethyl]benzenesulfonamide |
| SMILES | C=C(C)COCCNS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2NO3S/c1-9(2)8-18-6-5-15-19(16,17)10-3-4-11(13)12(14)7-10/h3-4,7,15H,1,5-6,8H2,2H3 |
| InChIKey | NBDYFRICGQHSKD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|