C12H16ClNO3S — CID 115698761
4-chloro-N-[2-(2-methylprop-2-enoxy)ethyl]benzenesulfonamide (PubChem CID 115698761) has the molecular formula C12H16ClNO3S and a molecular weight of 289.78 g/mol. Its IUPAC name is 4-chloro-N-[2-(2-methylprop-2-enoxy)ethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[2-(2-methylprop-2-enoxy)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 115698761 |
| Molecular Formula | C12H16ClNO3S |
| Molecular Weight | 289.78 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 4-chloro-N-[2-(2-methylprop-2-enoxy)ethyl]benzenesulfonamide |
| SMILES | C=C(C)COCCNS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H16ClNO3S/c1-10(2)9-17-8-7-14-18(15,16)12-5-3-11(13)4-6-12/h3-6,14H,1,7-9H2,2H3 |
| InChIKey | YTERKHMIMWYCFQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.78 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|