C9H12Cl2N2O2S — CID 28754074
N-(3-aminopropyl)-3,4-dichlorobenzenesulfonamide (PubChem CID 28754074) has the molecular formula C9H12Cl2N2O2S and a molecular weight of 283.18 g/mol. Its IUPAC name is N-(3-aminopropyl)-3,4-dichlorobenzenesulfonamide.
| Compound Name | N-(3-aminopropyl)-3,4-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 28754074 |
| Molecular Formula | C9H12Cl2N2O2S |
| Molecular Weight | 283.18 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | N-(3-aminopropyl)-3,4-dichlorobenzenesulfonamide |
| SMILES | NCCCNS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H12Cl2N2O2S/c10-8-3-2-7(6-9(8)11)16(14,15)13-5-1-4-12/h2-3,6,13H,1,4-5,12H2 |
| InChIKey | DHXLTSDIAKIDDL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.18 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|