C9H13Cl3N2O2S — CID 119961978
N-(3-aminopropyl)-3,5-dichlorobenzenesulfonamide;hydrochloride (PubChem CID 119961978) has the molecular formula C9H13Cl3N2O2S and a molecular weight of 319.64 g/mol. Its IUPAC name is N-(3-aminopropyl)-3,5-dichlorobenzenesulfonamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-3,5-dichlorobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119961978 |
| Molecular Formula | C9H13Cl3N2O2S |
| Molecular Weight | 319.64 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | N-(3-aminopropyl)-3,5-dichlorobenzenesulfonamide;hydrochloride |
| SMILES | Cl.NCCCNS(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C9H12Cl2N2O2S.ClH/c10-7-4-8(11)6-9(5-7)16(14,15)13-3-1-2-12;/h4-6,13H,1-3,12H2;1H |
| InChIKey | DFIJGKIRZHUWDP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.64 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|