C10H16ClFN2O2S — CID 86780635
N-(3-aminopropyl)-3-fluoro-5-methylbenzenesulfonamide;hydrochloride (PubChem CID 86780635) has the molecular formula C10H16ClFN2O2S and a molecular weight of 282.77 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-fluoro-5-methylbenzenesulfonamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-3-fluoro-5-methylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 86780635 |
| Molecular Formula | C10H16ClFN2O2S |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | N-(3-aminopropyl)-3-fluoro-5-methylbenzenesulfonamide;hydrochloride |
| SMILES | Cc1cc(F)cc(S(=O)(=O)NCCCN)c1.Cl |
| InChI | InChI=1S/C10H15FN2O2S.ClH/c1-8-5-9(11)7-10(6-8)16(14,15)13-4-2-3-12;/h5-7,13H,2-4,12H2,1H3;1H |
| InChIKey | SMGWMNSZDJTXCI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|