C9H13BrN2O2S — CID 120706185
N-(2-aminoethyl)-3-bromo-5-methylbenzenesulfonamide (PubChem CID 120706185) has the molecular formula C9H13BrN2O2S and a molecular weight of 293.19 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-bromo-5-methylbenzenesulfonamide.
| Compound Name | N-(2-aminoethyl)-3-bromo-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 120706185 |
| Molecular Formula | C9H13BrN2O2S |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | N-(2-aminoethyl)-3-bromo-5-methylbenzenesulfonamide |
| SMILES | Cc1cc(Br)cc(S(=O)(=O)NCCN)c1 |
| InChI | InChI=1S/C9H13BrN2O2S/c1-7-4-8(10)6-9(5-7)15(13,14)12-3-2-11/h4-6,12H,2-3,11H2,1H3 |
| InChIKey | HOZSMLZKZUKGAQ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |