C11H14Cl2N2O2S2 — CID 119962251
N-(3-aminopropyl)-5-chloro-1-benzothiophene-2-sulfonamide;hydrochloride (PubChem CID 119962251) has the molecular formula C11H14Cl2N2O2S2 and a molecular weight of 341.29 g/mol. Its IUPAC name is N-(3-aminopropyl)-5-chloro-1-benzothiophene-2-sulfonamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-5-chloro-1-benzothiophene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119962251 |
| Molecular Formula | C11H14Cl2N2O2S2 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | N-(3-aminopropyl)-5-chloro-1-benzothiophene-2-sulfonamide;hydrochloride |
| SMILES | Cl.NCCCNS(=O)(=O)c1cc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C11H13ClN2O2S2.ClH/c12-9-2-3-10-8(6-9)7-11(17-10)18(15,16)14-5-1-4-13;/h2-3,6-7,14H,1,4-5,13H2;1H |
| InChIKey | CDKVYVPYVJNMML-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|