C16H21ClN2O3S2 — CID 119992787
3-[1-[(5-chloro-1-benzothiophen-2-yl)sulfonyl]piperidin-4-yl]oxypropan-1-amine (PubChem CID 119992787) has the molecular formula C16H21ClN2O3S2 and a molecular weight of 388.94 g/mol. Its IUPAC name is 3-[1-[(5-chloro-1-benzothiophen-2-yl)sulfonyl]piperidin-4-yl]oxypropan-1-amine.
| Compound Name | 3-[1-[(5-chloro-1-benzothiophen-2-yl)sulfonyl]piperidin-4-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 119992787 |
| Molecular Formula | C16H21ClN2O3S2 |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 3-[1-[(5-chloro-1-benzothiophen-2-yl)sulfonyl]piperidin-4-yl]oxypropan-1-amine |
| SMILES | NCCCOC1CCN(S(=O)(=O)c2cc3cc(Cl)ccc3s2)CC1 |
| InChI | InChI=1S/C16H21ClN2O3S2/c17-13-2-3-15-12(10-13)11-16(23-15)24(20,21)19-7-4-14(5-8-19)22-9-1-6-18/h2-3,10-11,14H,1,4-9,18H2 |
| InChIKey | PDUIXHJAJYCVLQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|