C15H23Cl3N2O3S — CID 119992532
3-[1-[(3,5-dichlorophenyl)methylsulfonyl]piperidin-4-yl]oxypropan-1-amine;hydrochloride (PubChem CID 119992532) has the molecular formula C15H23Cl3N2O3S and a molecular weight of 417.79 g/mol. Its IUPAC name is 3-[1-[(3,5-dichlorophenyl)methylsulfonyl]piperidin-4-yl]oxypropan-1-amine;hydrochloride.
| Compound Name | 3-[1-[(3,5-dichlorophenyl)methylsulfonyl]piperidin-4-yl]oxypropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 119992532 |
| Molecular Formula | C15H23Cl3N2O3S |
| Molecular Weight | 417.79 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 3-[1-[(3,5-dichlorophenyl)methylsulfonyl]piperidin-4-yl]oxypropan-1-amine;hydrochloride |
| SMILES | Cl.NCCCOC1CCN(S(=O)(=O)Cc2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C15H22Cl2N2O3S.ClH/c16-13-8-12(9-14(17)10-13)11-23(20,21)19-5-2-15(3-6-19)22-7-1-4-18;/h8-10,15H,1-7,11,18H2;1H |
| InChIKey | JAXXTWDXJJAQQK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.79 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|