C11H11ClN2O3S2 — CID 71860322
3-[(5-chloro-1-benzothiophen-2-yl)sulfonylamino]propanamide (PubChem CID 71860322) has the molecular formula C11H11ClN2O3S2 and a molecular weight of 318.81 g/mol. Its IUPAC name is 3-[(5-chloro-1-benzothiophen-2-yl)sulfonylamino]propanamide.
| Compound Name | 3-[(5-chloro-1-benzothiophen-2-yl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 71860322 |
| Molecular Formula | C11H11ClN2O3S2 |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 3-[(5-chloro-1-benzothiophen-2-yl)sulfonylamino]propanamide |
| SMILES | NC(=O)CCNS(=O)(=O)c1cc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C11H11ClN2O3S2/c12-8-1-2-9-7(5-8)6-11(18-9)19(16,17)14-4-3-10(13)15/h1-2,5-6,14H,3-4H2,(H2,13,15) |
| InChIKey | VUPIALMRKWNAJK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |