C19H16ClN3O3S — CID 60589876
3-(benzylsulfamoyl)-4-chloro-N-pyridin-2-ylbenzamide (PubChem CID 60589876) has the molecular formula C19H16ClN3O3S and a molecular weight of 401.88 g/mol. Its IUPAC name is 3-(benzylsulfamoyl)-4-chloro-N-pyridin-2-ylbenzamide.
| Compound Name | 3-(benzylsulfamoyl)-4-chloro-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 60589876 |
| Molecular Formula | C19H16ClN3O3S |
| Molecular Weight | 401.88 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 3-(benzylsulfamoyl)-4-chloro-N-pyridin-2-ylbenzamide |
| SMILES | O=C(Nc1ccccn1)c1ccc(Cl)c(S(=O)(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C19H16ClN3O3S/c20-16-10-9-15(19(24)23-18-8-4-5-11-21-18)12-17(16)27(25,26)22-13-14-6-2-1-3-7-14/h1-12,22H,13H2,(H,21,23,24) |
| InChIKey | IFVHJNKZBJGMKL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.88 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |