C23H21ClN4O3S — CID 17480323
3-(benzylsulfamoyl)-4-chloro-N-[(1-methylbenzimidazol-2-yl)methyl]benzamide (PubChem CID 17480323) has the molecular formula C23H21ClN4O3S and a molecular weight of 468.97 g/mol. Its IUPAC name is 3-(benzylsulfamoyl)-4-chloro-N-[(1-methylbenzimidazol-2-yl)methyl]benzamide.
| Compound Name | 3-(benzylsulfamoyl)-4-chloro-N-[(1-methylbenzimidazol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 17480323 |
| Molecular Formula | C23H21ClN4O3S |
| Molecular Weight | 468.97 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 3-(benzylsulfamoyl)-4-chloro-N-[(1-methylbenzimidazol-2-yl)methyl]benzamide |
| SMILES | Cn1c(CNC(=O)c2ccc(Cl)c(S(=O)(=O)NCc3ccccc3)c2)nc2ccccc21 |
| InChI | InChI=1S/C23H21ClN4O3S/c1-28-20-10-6-5-9-19(20)27-22(28)15-25-23(29)17-11-12-18(24)21(13-17)32(30,31)26-14-16-7-3-2-4-8-16/h2-13,26H,14-15H2,1H3,(H,25,29) |
| InChIKey | RWIUQMXTEITWCG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.97 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |