C23H19ClN2O3S — CID 24615553
3-(benzylsulfamoyl)-4-chloro-N-(3-phenylprop-2-ynyl)benzamide (PubChem CID 24615553) has the molecular formula C23H19ClN2O3S and a molecular weight of 438.94 g/mol. Its IUPAC name is 3-(benzylsulfamoyl)-4-chloro-N-(3-phenylprop-2-ynyl)benzamide.
| Compound Name | 3-(benzylsulfamoyl)-4-chloro-N-(3-phenylprop-2-ynyl)benzamide |
|---|---|
| PubChem CID | 24615553 |
| Molecular Formula | C23H19ClN2O3S |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 3-(benzylsulfamoyl)-4-chloro-N-(3-phenylprop-2-ynyl)benzamide |
| SMILES | O=C(NCC#Cc1ccccc1)c1ccc(Cl)c(S(=O)(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C23H19ClN2O3S/c24-21-14-13-20(23(27)25-15-7-12-18-8-3-1-4-9-18)16-22(21)30(28,29)26-17-19-10-5-2-6-11-19/h1-6,8-11,13-14,16,26H,15,17H2,(H,25,27) |
| InChIKey | PPDSFTPWBVJKOV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|