C10H12NO5S- — CID 7024656
3-(2-hydroxyethylsulfamoyl)-4-methylbenzoate (PubChem CID 7024656) has the molecular formula C10H12NO5S- and a molecular weight of 258.27 g/mol. Its IUPAC name is 3-(2-hydroxyethylsulfamoyl)-4-methylbenzoate.
| Compound Name | 3-(2-hydroxyethylsulfamoyl)-4-methylbenzoate |
|---|---|
| PubChem CID | 7024656 |
| Molecular Formula | C10H12NO5S- |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 3-(2-hydroxyethylsulfamoyl)-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)[O-])cc1S(=O)(=O)NCCO |
| InChI | InChI=1S/C10H13NO5S/c1-7-2-3-8(10(13)14)6-9(7)17(15,16)11-4-5-12/h2-3,6,11-12H,4-5H2,1H3,(H,13,14)/p-1 |
| InChIKey | WGORYHSYKOIFNI-UHFFFAOYSA-M |
| XLogP | -1.37 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |