C10H11FNO5S- — CID 9160422
4-fluoro-3-(2-methoxyethylsulfamoyl)benzoate (PubChem CID 9160422) has the molecular formula C10H11FNO5S- and a molecular weight of 276.26 g/mol. Its IUPAC name is 4-fluoro-3-(2-methoxyethylsulfamoyl)benzoate.
| Compound Name | 4-fluoro-3-(2-methoxyethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 9160422 |
| Molecular Formula | C10H11FNO5S- |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 4-fluoro-3-(2-methoxyethylsulfamoyl)benzoate |
| SMILES | COCCNS(=O)(=O)c1cc(C(=O)[O-])ccc1F |
| InChI | InChI=1S/C10H12FNO5S/c1-17-5-4-12-18(15,16)9-6-7(10(13)14)2-3-8(9)11/h2-3,6,12H,4-5H2,1H3,(H,13,14)/p-1 |
| InChIKey | UCUQFBFOEOUIBD-UHFFFAOYSA-M |
| XLogP | -0.89 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|