C13H11FNO4S2- — CID 9160250
4-fluoro-3-(2-thiophen-2-ylethylsulfamoyl)benzoate (PubChem CID 9160250) has the molecular formula C13H11FNO4S2- and a molecular weight of 328.37 g/mol. Its IUPAC name is 4-fluoro-3-(2-thiophen-2-ylethylsulfamoyl)benzoate.
| Compound Name | 4-fluoro-3-(2-thiophen-2-ylethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 9160250 |
| Molecular Formula | C13H11FNO4S2- |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 4-fluoro-3-(2-thiophen-2-ylethylsulfamoyl)benzoate |
| SMILES | O=C([O-])c1ccc(F)c(S(=O)(=O)NCCc2cccs2)c1 |
| InChI | InChI=1S/C13H12FNO4S2/c14-11-4-3-9(13(16)17)8-12(11)21(18,19)15-6-5-10-2-1-7-20-10/h1-4,7-8,15H,5-6H2,(H,16,17)/p-1 |
| InChIKey | VFOOWTSBMFAOMU-UHFFFAOYSA-M |
| XLogP | 0.77 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |